CAS 1261997-88-9

5-(3-Chlorophenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid

Description:

5-(3-Chlorophenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid, identified by its CAS number 1261997-88-9, is a chemical compound that features a pyridine ring substituted with a chlorophenyl group and a carboxylic acid functional group. This compound typically exhibits characteristics common to pyridine derivatives, such as moderate solubility in polar solvents and potential biological activity due to its structural features. The presence of the chlorophenyl moiety may impart specific electronic properties, influencing its reactivity and interaction with biological targets. The keto group in the 6-position contributes to the compound's stability and may participate in hydrogen bonding, enhancing its potential as a ligand in coordination chemistry. Additionally, the carboxylic acid group can engage in acid-base reactions, making it a versatile compound in synthetic chemistry. Overall, this substance may be of interest in pharmaceutical research and development, particularly in the context of drug design and synthesis.

Formula: C₁₂H₈ClNO₃

InChI: InChI=1S/C12H8ClNO3/c13-9-3-1-2-7(4-9)10-5-8(12(16)17)6-14-11(10)15/h1-6H,(H,14,15)(H,16,17)

InChI key: InChIKey=AGBYSGIIXDACIG-UHFFFAOYSA-N

SMILES: O=C1C(=CC(C(O)=O)=CN1)C2=CC(Cl)=CC=C2

Synonyms:

• 5-(3-Chlorophenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 5-(3-chlorophenyl)-1,6-dihydro-6-oxo-