CAS 1261997-93-6

2′,5′-Dichloro-3-methoxy[1,1′-biphenyl]-4-ol

Description:

2′,5′-Dichloro-3-methoxy[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two chlorine atoms at the 2′ and 5′ positions on one of the phenyl rings contributes to its halogenated nature, while the methoxy group (-OCH3) at the 3 position and a hydroxyl group (-OH) at the 4 position enhance its reactivity and solubility in polar solvents. This compound is likely to exhibit properties typical of phenolic compounds, such as antioxidant activity and potential biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its molecular structure suggests it may participate in hydrogen bonding due to the hydroxyl group, influencing its physical properties like melting point and solubility. Additionally, the dichloro substitution may affect its electronic properties, potentially altering its reactivity in chemical reactions. Overall, 2′,5′-Dichloro-3-methoxy[1,1′-biphenyl]-4-ol is a complex molecule with diverse potential applications.

Formula: C₁₃H₁₀Cl₂O₂

InChI: InChI=1S/C13H10Cl2O2/c1-17-13-6-8(2-5-12(13)16)10-7-9(14)3-4-11(10)15/h2-7,16H,1H3

InChI key: InChIKey=NSBZQNRXMIQDFO-UHFFFAOYSA-N

SMILES: ClC1=C(C2=CC(OC)=C(O)C=C2)C=C(Cl)C=C1

Synonyms:

• [1,1′-Biphenyl]-4-ol, 2′,5′-dichloro-3-methoxy-
• 2′,5′-Dichloro-3-methoxy[1,1′-biphenyl]-4-ol