CAS 1261998-00-8

3′-(1-Pyrrolidinylcarbonyl)[1,1′-biphenyl]-4-carboxylic acid

Description:

3′-(1-Pyrrolidinylcarbonyl)[1,1′-biphenyl]-4-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) at one end of the biphenyl moiety contributes to its acidic properties, while the pyrrolidinylcarbonyl group introduces a nitrogen-containing heterocycle that can influence its reactivity and solubility. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored in pharmacological studies. Additionally, the compound's solubility and stability in various solvents can be influenced by the functional groups present, affecting its application in synthetic and analytical chemistry. Overall, 3′-(1-Pyrrolidinylcarbonyl)[1,1′-biphenyl]-4-carboxylic acid represents a unique chemical entity with potential utility in various scientific fields.

Formula: C₁₈H₁₇NO₃

InChI: InChI=1S/C18H17NO3/c20-17(19-10-1-2-11-19)16-5-3-4-15(12-16)13-6-8-14(9-7-13)18(21)22/h3-9,12H,1-2,10-11H2,(H,21,22)

InChI key: InChIKey=FNBGBJXAPCSIPB-UHFFFAOYSA-N

SMILES: C(=O)(C=1C=C(C=CC1)C2=CC=C(C(O)=O)C=C2)N3CCCC3

Synonyms:

• [1,1′-Biphenyl]-4-carboxylic acid, 3′-(1-pyrrolidinylcarbonyl)-
• 3′-(1-Pyrrolidinylcarbonyl)[1,1′-biphenyl]-4-carboxylic acid