CAS 1261998-17-7

5-(2,6-Difluorophenyl)-2-methoxy-3-pyridinecarboxylic acid

Description:

5-(2,6-Difluorophenyl)-2-methoxy-3-pyridinecarboxylic acid is a chemical compound characterized by its unique molecular structure, which includes a pyridine ring substituted with a carboxylic acid group and a methoxy group, as well as a difluorophenyl moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The difluorophenyl group may enhance lipophilicity and influence biological activity, while the carboxylic acid group can participate in hydrogen bonding and ionic interactions. The methoxy group can also affect solubility and reactivity. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods, including NMR, mass spectrometry, and chromatography. Overall, this compound represents a valuable structure for further investigation in medicinal chemistry and related fields.

Formula: C₁₃H₉F₂NO₃

InChI: InChI=1S/C13H9F2NO3/c1-19-12-8(13(17)18)5-7(6-16-12)11-9(14)3-2-4-10(11)15/h2-6H,1H3,(H,17,18)

InChI key: InChIKey=HVSRHNRFKSOTHD-UHFFFAOYSA-N

SMILES: FC1=C(C(F)=CC=C1)C=2C=C(C(O)=O)C(OC)=NC2

Synonyms:

• 5-(2,6-Difluorophenyl)-2-methoxy-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 5-(2,6-difluorophenyl)-2-methoxy-