CAS 1261998-20-2
:4′-Ethoxy-2-fluoro-2′-methyl[1,1′-biphenyl]-4-ol
Description:
4′-Ethoxy-2-fluoro-2′-methyl[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an ethoxy group (-OCH2CH3) at the para position of one phenyl ring, a fluoro group (-F) at the ortho position, and a methyl group (-CH3) at the meta position contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the presence of the hydroxyl (-OH) group, which can engage in hydrogen bonding, influencing its solubility in various solvents. The fluorine atom may impart specific reactivity and stability characteristics, while the ethoxy group can enhance lipophilicity. Such structural features suggest potential applications in pharmaceuticals or agrochemicals, where modifications to biphenyl derivatives are often explored for biological activity. Overall, the compound's functional groups and structural arrangement play a crucial role in determining its chemical behavior and potential applications.
Formula:C15H15FO2
InChI:InChI=1S/C15H15FO2/c1-3-18-12-5-7-13(10(2)8-12)14-6-4-11(17)9-15(14)16/h4-9,17H,3H2,1-2H3
InChI key:InChIKey=IHEWVZZGMJNCIQ-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(OCC)=C1)C2=C(F)C=C(O)C=C2
Synonyms:- 4′-Ethoxy-2-fluoro-2′-methyl[1,1′-biphenyl]-4-ol
- [1,1′-Biphenyl]-4-ol, 4′-ethoxy-2-fluoro-2′-methyl-
- 4-(4-Ethoxy-2-Methylphenyl)-3-fluorophenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.