
CAS 1261998-26-8
:2-Amino-5-(3,5-difluorophenyl)-4-pyridinecarboxylic acid
Description:
2-Amino-5-(3,5-difluorophenyl)-4-pyridinecarboxylic acid is a chemical compound characterized by its pyridine and carboxylic acid functional groups, along with an amino group and a difluorophenyl substituent. This compound features a pyridine ring, which contributes to its aromatic properties and potential biological activity. The presence of the amino group enhances its solubility in polar solvents and may facilitate interactions with biological targets. The difluorophenyl group introduces electronegative fluorine atoms, which can influence the compound's electronic properties, stability, and reactivity. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of fluorine atoms can enhance metabolic stability and bioavailability. Overall, 2-Amino-5-(3,5-difluorophenyl)-4-pyridinecarboxylic acid represents a versatile scaffold for further chemical modifications and investigations in various fields, including pharmaceuticals and agrochemicals.
Formula:C12H8F2N2O2
InChI:InChI=1S/C12H8F2N2O2/c13-7-1-6(2-8(14)3-7)10-5-16-11(15)4-9(10)12(17)18/h1-5H,(H2,15,16)(H,17,18)
InChI key:InChIKey=YGYMGADJRGWVMC-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CN=C(N)C1)C2=CC(F)=CC(F)=C2
Synonyms:- 4-Pyridinecarboxylic acid, 2-amino-5-(3,5-difluorophenyl)-
- 2-Amino-5-(3,5-difluorophenyl)-4-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.