
CAS 1261998-27-9
:2-(3,5-Difluorophenyl)-4-pyridinol
Description:
2-(3,5-Difluorophenyl)-4-pyridinol is an organic compound characterized by its unique structure, which includes a pyridine ring and a difluorophenyl group. The presence of the pyridinol moiety indicates that it contains a hydroxyl group (-OH) attached to the pyridine ring, contributing to its potential as a weak acid. The difluorophenyl substituent enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. This compound may exhibit various properties such as solubility in organic solvents, moderate stability under standard conditions, and potential reactivity due to the presence of both the fluorine atoms and the hydroxyl group. Its molecular interactions can be influenced by hydrogen bonding and dipole-dipole interactions, which are significant in determining its behavior in biological systems. Overall, 2-(3,5-Difluorophenyl)-4-pyridinol is a compound that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C11H7F2NO
InChI:InChI=1S/C11H7F2NO/c12-8-3-7(4-9(13)5-8)11-6-10(15)1-2-14-11/h1-6H,(H,14,15)
InChI key:InChIKey=DDKDXUAAQKDHTH-UHFFFAOYSA-N
SMILES:FC=1C=C(C=C(F)C1)C2=CC(O)=CC=N2
Synonyms:- 4-Pyridinol, 2-(3,5-difluorophenyl)-
- 2-(3,5-Difluorophenyl)-4-pyridinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.