
CAS 1261998-61-1
:3′-(1-Pyrrolidinylcarbonyl)[1,1′-biphenyl]-3-carboxylic acid
Description:
3′-(1-Pyrrolidinylcarbonyl)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) at the 3-position of the biphenyl moiety indicates its potential for acidic behavior and reactivity in various chemical reactions. The pyrrolidinylcarbonyl substituent introduces a nitrogen-containing heterocycle, which can enhance the compound's solubility and biological activity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Additionally, its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. The compound's CAS number, 1261998-61-1, allows for easy identification and retrieval of data related to its properties, synthesis, and applications in scientific literature. Overall, this compound represents a unique combination of aromatic and heterocyclic chemistry, with implications for both synthetic and applied chemistry.
Formula:C18H17NO3
InChI:InChI=1S/C18H17NO3/c20-17(19-9-1-2-10-19)15-7-3-5-13(11-15)14-6-4-8-16(12-14)18(21)22/h3-8,11-12H,1-2,9-10H2,(H,21,22)
InChI key:InChIKey=AOFAODUGSQZMLH-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=C(C=CC1)C2=CC(C(O)=O)=CC=C2)N3CCCC3
Synonyms:- 3′-(1-Pyrrolidinylcarbonyl)[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 3′-(1-pyrrolidinylcarbonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.