CymitQuimica logo

CAS 1261998-63-3

:

4′-Chloro-3′-methyl[1,1′-biphenyl]-3-ol

Description:
4′-Chloro-3′-methyl[1,1′-biphenyl]-3-ol, identified by its CAS number 1261998-63-3, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chlorine atom at the para position and a methyl group at the meta position relative to the hydroxyl group (–OH) on one of the phenyl rings contributes to its unique chemical properties. This compound is likely to exhibit moderate hydrophobicity due to its aromatic nature, while the hydroxyl group introduces some degree of polarity, allowing for potential hydrogen bonding interactions. The chlorine substituent may influence the compound's reactivity and stability, potentially affecting its behavior in various chemical reactions. Additionally, the compound may have applications in fields such as pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and biological activity. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or environmental impact.
Formula:C13H11ClO
InChI:InChI=1S/C13H11ClO/c1-9-7-11(5-6-13(9)14)10-3-2-4-12(15)8-10/h2-8,15H,1H3
InChI key:InChIKey=CBVVFDDISGATRC-UHFFFAOYSA-N
SMILES:CC=1C=C(C=CC1Cl)C2=CC(O)=CC=C2
Synonyms:
  • [1,1′-Biphenyl]-3-ol, 4′-chloro-3′-methyl-
  • 4′-Chloro-3′-methyl[1,1′-biphenyl]-3-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.