
CAS 1261998-64-4
:2′,3′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carbonitrile
Description:
2′,3′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carbonitrile is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2′ and 3′ positions of the biphenyl moiety contributes to its unique electronic properties, potentially enhancing its reactivity and solubility in various solvents. The hydroxyl group at the 3-position introduces polarity, which can influence hydrogen bonding and solvation behavior. Additionally, the carbonitrile functional group at the 4-position adds to the compound's versatility, as it can participate in nucleophilic reactions and serve as a potential site for further chemical modifications. This compound may exhibit interesting biological activities or applications in materials science, particularly in the development of pharmaceuticals or agrochemicals. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure, which can be further explored through experimental studies.
Formula:C13H7F2NO
InChI:InChI=1S/C13H7F2NO/c14-11-3-1-2-10(13(11)15)8-4-5-9(7-16)12(17)6-8/h1-6,17H
InChI key:InChIKey=ASZBQHJPCUOFLK-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1F)C2=CC(O)=C(C#N)C=C2
Synonyms:- 2′,3′-Difluoro-3-hydroxy[1,1′-biphenyl]-4-carbonitrile
- [1,1′-Biphenyl]-4-carbonitrile, 2′,3′-difluoro-3-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.