CymitQuimica logo

CAS 1261998-75-7

:

6-(3-Chloro-4-fluorophenyl)-3-pyridinol

Description:
6-(3-Chloro-4-fluorophenyl)-3-pyridinol is a chemical compound characterized by its pyridine ring, which is substituted at the 3-position with a hydroxyl group and at the 6-position with a phenyl group that contains both a chlorine and a fluorine atom. This structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The presence of the halogen substituents (chlorine and fluorine) can influence the compound's lipophilicity, stability, and interaction with biological targets. The compound may exhibit properties such as antimicrobial or anti-inflammatory activity, depending on its specific interactions within biological systems. Additionally, its molecular structure suggests potential for hydrogen bonding due to the hydroxyl group, which can affect solubility and reactivity. As with many organic compounds, the synthesis, purification, and characterization of this substance would involve standard organic chemistry techniques, and its safety profile would need to be evaluated for any practical applications.
Formula:C11H7ClFNO
InChI:InChI=1S/C11H7ClFNO/c12-9-5-7(1-3-10(9)13)11-4-2-8(15)6-14-11/h1-6,15H
InChI key:InChIKey=LEHTUEJDTHMINT-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1F)C2=CC=C(O)C=N2
Synonyms:
  • 3-Pyridinol, 6-(3-chloro-4-fluorophenyl)-
  • 6-(3-Chloro-4-fluorophenyl)-3-pyridinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.