
CAS 1261998-76-8
:5-(4-Carboxyphenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid
Description:
5-(4-Carboxyphenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid, with the CAS number 1261998-76-8, is a chemical compound characterized by its complex structure that includes both pyridine and carboxylic acid functional groups. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, reactivity, and potential biological activity. The presence of multiple carboxylic acid groups suggests it may engage in hydrogen bonding and participate in various acid-base reactions. Additionally, the dihydro and keto functionalities contribute to its potential as a versatile intermediate in organic synthesis. The compound may also exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its stability, reactivity, and interactions with other molecules can be influenced by environmental factors such as pH and temperature. Overall, this compound's unique structural features position it as a valuable candidate for further research in both synthetic and applied chemistry contexts.
Formula:C13H9NO5
InChI:InChI=1S/C13H9NO5/c15-11-5-9(13(18)19)10(6-14-11)7-1-3-8(4-2-7)12(16)17/h1-6H,(H,14,15)(H,16,17)(H,18,19)
InChI key:InChIKey=KKAPNPONHCKREI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CNC(=O)C1)C2=CC=C(C(O)=O)C=C2
Synonyms:- 4-Pyridinecarboxylic acid, 5-(4-carboxyphenyl)-1,2-dihydro-2-oxo-
- 5-(4-Carboxyphenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.