CAS 1261999-46-5
:Methyl 3-chloro-3′-fluoro-4′-hydroxy[1,1′-biphenyl]-4-carboxylate
Description:
Methyl 3-chloro-3′-fluoro-4′-hydroxy[1,1′-biphenyl]-4-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylate group indicates that it is an ester, specifically a methyl ester, which contributes to its reactivity and solubility properties. The compound features a chlorine atom and a fluorine atom, which are halogen substituents that can influence its chemical behavior, including its reactivity and potential biological activity. The hydroxy group provides the compound with polar characteristics, enhancing its solubility in polar solvents. This compound may exhibit interesting properties due to the combination of halogen substituents and the hydroxy group, potentially making it useful in various applications, including pharmaceuticals or agrochemicals. Its specific interactions and stability would depend on the surrounding environment and conditions, such as pH and temperature. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C14H10ClFO3
InChI:InChI=1S/C14H10ClFO3/c1-19-14(18)10-4-2-8(6-11(10)15)9-3-5-13(17)12(16)7-9/h2-7,17H,1H3
InChI key:InChIKey=GYJKDFMONVCQLQ-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1C(OC)=O)C2=CC(F)=C(O)C=C2
Synonyms:- [1,1′-Biphenyl]-4-carboxylic acid, 3-chloro-3′-fluoro-4′-hydroxy-, methyl ester
- Methyl 3-chloro-3′-fluoro-4′-hydroxy[1,1′-biphenyl]-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
