CymitQuimica logo

CAS 1262-31-3

:

2,2′-Thiobis[4-dodecylphenol]

Description:
2,2′-Thiobis[4-dodecylphenol], with the CAS number 1262-31-3, is an organic compound characterized by its structure, which features two dodecylphenol groups linked by a sulfur atom. This compound is typically a solid at room temperature and exhibits a high molecular weight due to the long dodecyl chains. It is known for its antioxidant properties, making it useful in various applications, particularly in the stabilization of polymers and plastics against oxidative degradation. The presence of the dodecyl groups enhances its hydrophobic characteristics, allowing it to effectively interact with non-polar environments. Additionally, 2,2′-Thiobis[4-dodecylphenol] can exhibit thermal stability, which is beneficial in high-temperature applications. Its chemical behavior includes potential reactivity with free radicals, contributing to its role as a stabilizer. Safety data indicates that, like many phenolic compounds, it should be handled with care due to potential irritant effects. Overall, this compound plays a significant role in materials science and industrial applications due to its functional properties.
Formula:C36H58O2S
InChI:InChI=1S/C36H58O2S/c1-3-5-7-9-11-13-15-17-19-21-23-31-25-27-33(37)35(29-31)39-36-30-32(26-28-34(36)38)24-22-20-18-16-14-12-10-8-6-4-2/h25-30,37-38H,3-24H2,1-2H3
InChI key:InChIKey=QDRFHDDAGLWIAJ-UHFFFAOYSA-N
SMILES:S(C1=CC(CCCCCCCCCCCC)=CC=C1O)C2=CC(CCCCCCCCCCCC)=CC=C2O
Synonyms:
  • Phenol, 2,2′-thiobis[4-dodecyl-
  • 2,2′-Thiobis[4-dodecylphenol]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.