
CAS 1262000-16-7
:Methyl 6-fluoro-3′-hydroxy-4′-methoxy[1,1′-biphenyl]-3-carboxylate
Description:
Methyl 6-fluoro-3′-hydroxy-4′-methoxy[1,1′-biphenyl]-3-carboxylate is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH3) and a hydroxyl group (-OH) on the biphenyl framework contributes to its potential for hydrogen bonding and influences its solubility and reactivity. The fluorine atom at the 6-position enhances the compound's lipophilicity and may affect its biological activity. As an ester, the methyl carboxylate group indicates that it can undergo hydrolysis to yield the corresponding acid and alcohol. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions and applications would depend on further studies, including its synthesis, stability, and biological assays. Overall, the unique functional groups and structural features of this compound suggest potential utility in various chemical and pharmaceutical applications.
Formula:C15H13FO4
InChI:InChI=1S/C15H13FO4/c1-19-14-6-4-9(8-13(14)17)11-7-10(15(18)20-2)3-5-12(11)16/h3-8,17H,1-2H3
InChI key:InChIKey=ZDANKIKGOHWMML-UHFFFAOYSA-N
SMILES:FC=1C(=CC(C(OC)=O)=CC1)C2=CC(O)=C(OC)C=C2
Synonyms:- Methyl 6-fluoro-3′-hydroxy-4′-methoxy[1,1′-biphenyl]-3-carboxylate
- [1,1′-Biphenyl]-3-carboxylic acid, 6-fluoro-3′-hydroxy-4′-methoxy-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.