CAS 1262000-46-3

4-(3-Cyano-4-hydroxyphenyl)-2-thiophenecarboxylic acid

Description:

4-(3-Cyano-4-hydroxyphenyl)-2-thiophenecarboxylic acid is an organic compound characterized by its complex structure, which includes a thiophene ring and a phenolic group. This compound features a cyano group and a hydroxyl group on the aromatic ring, contributing to its potential reactivity and solubility properties. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit acidic behavior in solution. The thiophene moiety adds to the compound's aromatic character and may influence its electronic properties, making it of interest in various applications, including organic electronics and pharmaceuticals. Additionally, the cyano group can enhance the compound's ability to engage in nucleophilic reactions, while the hydroxyl group may facilitate hydrogen bonding interactions. Overall, this compound's unique combination of functional groups suggests potential utility in materials science and medicinal chemistry, although specific applications would depend on further research into its properties and behavior in different environments.

Formula: C₁₂H₇NO₃S

InChI: InChI=1S/C12H7NO3S/c13-5-8-3-7(1-2-10(8)14)9-4-11(12(15)16)17-6-9/h1-4,6,14H,(H,15,16)

InChI key: InChIKey=MKWSGLLZIGCEST-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CS1)C2=CC(C#N)=C(O)C=C2

Synonyms:

• 4-(3-Cyano-4-hydroxyphenyl)-2-thiophenecarboxylic acid
• 2-Thiophenecarboxylic acid, 4-(3-cyano-4-hydroxyphenyl)-