CymitQuimica logo

CAS 1262000-56-5

:

3-Methoxy-2′,3′-dimethyl[1,1′-biphenyl]-4-ol

Description:
3-Methoxy-2′,3′-dimethyl[1,1′-biphenyl]-4-ol, identified by its CAS number 1262000-56-5, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a methoxy group (-OCH3) and a hydroxyl group (-OH) attached to the biphenyl framework, contributing to its chemical reactivity and potential applications. The presence of the dimethyl groups enhances its hydrophobic characteristics, influencing its solubility in organic solvents. The hydroxyl group can participate in hydrogen bonding, which may affect its physical properties, such as boiling and melting points. Additionally, the methoxy group can influence the electronic properties of the molecule, potentially affecting its reactivity and interactions with other substances. This compound may be of interest in various fields, including organic synthesis, materials science, and pharmaceuticals, due to its unique structural features and functional groups. However, specific applications and biological activities would require further investigation.
Formula:C15H16O2
InChI:InChI=1S/C15H16O2/c1-10-5-4-6-13(11(10)2)12-7-8-14(16)15(9-12)17-3/h4-9,16H,1-3H3
InChI key:InChIKey=ZNEQWHKLXWEWEQ-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1C)C2=CC(OC)=C(O)C=C2
Synonyms:
  • 3-Methoxy-2′,3′-dimethyl[1,1′-biphenyl]-4-ol
  • [1,1′-Biphenyl]-4-ol, 3-methoxy-2′,3′-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.