CAS 1262000-67-8

5-(3,4-Dimethoxyphenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid

Description:

5-(3,4-Dimethoxyphenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid, with the CAS number 1262000-67-8, is a chemical compound characterized by its unique structure that includes a pyridine ring and a phenyl group substituted with methoxy groups. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, stability, and reactivity. The presence of the carboxylic acid functional group suggests potential acidity and the ability to form salts or esters. The dimethoxy substitution on the phenyl ring can enhance lipophilicity and may affect biological activity, making it of interest in medicinal chemistry. Additionally, the diketone functionality in the pyridine ring may participate in various chemical reactions, including condensation and oxidation. Overall, this compound's characteristics make it a subject of interest for further research, particularly in the fields of organic synthesis and pharmacology.

Formula: C₁₄H₁₃NO₅

InChI: InChI=1S/C14H13NO5/c1-19-11-4-3-8(5-12(11)20-2)10-7-15-13(16)6-9(10)14(17)18/h3-7H,1-2H3,(H,15,16)(H,17,18)

InChI key: InChIKey=SFARTIGXUHITDF-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(=CNC(=O)C1)C2=CC(OC)=C(OC)C=C2

Synonyms:

• 4-Pyridinecarboxylic acid, 5-(3,4-dimethoxyphenyl)-1,2-dihydro-2-oxo-
• 5-(3,4-Dimethoxyphenyl)-1,2-dihydro-2-oxo-4-pyridinecarboxylic acid