CymitQuimica logo

CAS 1262000-84-9

:

5-(5-Carboxy-2-fluorophenyl)-2-methoxy-3-pyridinecarboxylic acid

Description:
5-(5-Carboxy-2-fluorophenyl)-2-methoxy-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and multiple functional groups. This substance features a carboxylic acid group, a methoxy group, and a fluorinated phenyl group, contributing to its potential reactivity and solubility properties. The presence of the fluorine atom can enhance the compound's lipophilicity and influence its biological activity. The carboxylic acid functionality allows for hydrogen bonding and can participate in various chemical reactions, making it a versatile building block in organic synthesis. Additionally, the methoxy group can affect the electronic properties of the molecule, potentially impacting its interaction with biological targets. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could lead to specific pharmacological activities. Overall, its unique combination of functional groups suggests potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C14H10FNO5
InChI:InChI=1S/C14H10FNO5/c1-21-12-10(14(19)20)5-8(6-16-12)9-4-7(13(17)18)2-3-11(9)15/h2-6H,1H3,(H,17,18)(H,19,20)
InChI key:InChIKey=YVTCESFZBNZWHC-UHFFFAOYSA-N
SMILES:FC=1C(C=2C=C(C(O)=O)C(OC)=NC2)=CC(C(O)=O)=CC1
Synonyms:
  • 5-(5-Carboxy-2-fluorophenyl)-2-methoxy-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 5-(5-carboxy-2-fluorophenyl)-2-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.