CymitQuimica logo

CAS 1262001-04-6

:

5′-Cyano-2′-fluoro[1,1′-biphenyl]-2-carboxylic acid

Description:
5′-Cyano-2′-fluoro[1,1′-biphenyl]-2-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a cyano group (-CN) and a fluoro group (-F) at specific positions on the biphenyl framework contributes to its unique chemical properties. The carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. This compound is likely to be of interest in pharmaceutical and materials science research due to its potential applications in drug development and as a building block in organic synthesis. Its molecular structure suggests that it may exhibit interesting electronic properties, which could be relevant in the design of organic electronic materials. Additionally, the presence of the cyano and fluoro substituents may enhance its reactivity and stability under certain conditions, making it a valuable compound for further study in synthetic chemistry.
Formula:C14H8FNO2
InChI:InChI=1S/C14H8FNO2/c15-13-6-5-9(8-16)7-12(13)10-3-1-2-4-11(10)14(17)18/h1-7H,(H,17,18)
InChI key:InChIKey=KABJXCAYNANJKA-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=C1)C2=CC(C#N)=CC=C2F
Synonyms:
  • [1,1′-Biphenyl]-2-carboxylic acid, 5′-cyano-2′-fluoro-
  • 5′-Cyano-2′-fluoro[1,1′-biphenyl]-2-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.