CAS 1262001-10-4

Methyl 3′-chloro-5′-hydroxy[1,1′-biphenyl]-3-carboxylate

Description:

Methyl 3′-chloro-5′-hydroxy[1,1′-biphenyl]-3-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylate group indicates that it is an ester, specifically a methyl ester, which contributes to its solubility in organic solvents. The compound features a chlorine atom and a hydroxyl group at specific positions on the biphenyl framework, which can influence its reactivity and potential biological activity. The chlorine substituent may enhance lipophilicity, while the hydroxyl group can participate in hydrogen bonding, affecting the compound's physical properties such as melting point and boiling point. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development or as a precursor in synthetic pathways. Its specific interactions and stability would depend on the surrounding conditions and the presence of other functional groups in a given reaction environment.

Formula: C₁₄H₁₁ClO₃

InChI: InChI=1S/C14H11ClO3/c1-18-14(17)10-4-2-3-9(5-10)11-6-12(15)8-13(16)7-11/h2-8,16H,1H3

InChI key: InChIKey=POSSKSIDZUTBRI-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C(C=CC1)C2=CC(Cl)=CC(O)=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 3′-chloro-5′-hydroxy-, methyl ester
• Methyl 3′-chloro-5′-hydroxy[1,1′-biphenyl]-3-carboxylate