CAS 1262001-60-4

2′-Fluoro-3-methoxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-ol

Description:

2′-Fluoro-3-methoxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-ol is a chemical compound characterized by its complex structure, which includes a biphenyl framework substituted with various functional groups. The presence of a fluoro group at the 2′ position and a trifluoromethyl group at the 3′ position contributes to its unique electronic properties, potentially enhancing its reactivity and solubility in organic solvents. The methoxy group at the 3 position serves as an electron-donating substituent, which can influence the compound's overall polarity and interaction with other molecules. Additionally, the hydroxyl group at the 4 position introduces hydrogen bonding capabilities, which may affect its physical properties, such as boiling and melting points, as well as its solubility in polar solvents. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and material science. Its specific applications and behavior would depend on the context of its use and the interactions with other chemical entities.

Formula: C₁₄H₁₀F₄O₂

InChI: InChI=1S/C14H10F4O2/c1-20-12-7-8(5-6-11(12)19)9-3-2-4-10(13(9)15)14(16,17)18/h2-7,19H,1H3

InChI key: InChIKey=PTTLEMCIYQDGAG-UHFFFAOYSA-N

SMILES: FC1=C(C=CC=C1C(F)(F)F)C2=CC(OC)=C(O)C=C2

Synonyms:

• 2′-Fluoro-3-methoxy-3′-(trifluoromethyl)[1,1′-biphenyl]-4-ol
• [1,1′-Biphenyl]-4-ol, 2′-fluoro-3-methoxy-3′-(trifluoromethyl)-