CymitQuimica logo

CAS 1262001-76-2

:

2′-Fluoro-4′-hydroxy[1,1′-biphenyl]-2-methanol

Description:
2′-Fluoro-4′-hydroxy[1,1′-biphenyl]-2-methanol, identified by its CAS number 1262001-76-2, is an organic compound characterized by the presence of a biphenyl structure with specific functional groups. This compound features a fluorine atom at the 2' position and a hydroxyl group at the 4' position of one of the phenyl rings, along with a methanol group at the 2 position of the biphenyl framework. The presence of these functional groups suggests that the compound may exhibit interesting chemical reactivity and potential applications in fields such as pharmaceuticals or materials science. The hydroxyl group contributes to its polarity, potentially influencing its solubility in various solvents, while the fluorine atom can enhance the compound's biological activity or stability. Additionally, the biphenyl structure may impart unique electronic properties, making it a candidate for further study in organic synthesis or as a building block in more complex chemical systems. Overall, the compound's characteristics are defined by its functional groups and biphenyl backbone, which together influence its chemical behavior and potential applications.
Formula:C13H11FO2
InChI:InChI=1S/C13H11FO2/c14-13-7-10(16)5-6-12(13)11-4-2-1-3-9(11)8-15/h1-7,15-16H,8H2
InChI key:InChIKey=NQBVCLMUVPTNGN-UHFFFAOYSA-N
SMILES:C(O)C1=C(C=CC=C1)C2=C(F)C=C(O)C=C2
Synonyms:
  • 2′-Fluoro-4′-hydroxy[1,1′-biphenyl]-2-methanol
  • [1,1′-Biphenyl]-2-methanol, 2′-fluoro-4′-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.