CymitQuimica logo

CAS 1262001-85-3

:

4-Fluoro-3′-methoxy[1,1′-biphenyl]-3-ol

Description:
4-Fluoro-3′-methoxy[1,1′-biphenyl]-3-ol, identified by its CAS number 1262001-85-3, is an organic compound characterized by the presence of a biphenyl structure with specific substituents. This compound features a fluorine atom at the 4-position and a methoxy group at the 3′-position of the biphenyl moiety, along with a hydroxyl group at the 3-position. The presence of these functional groups contributes to its chemical properties, including potential polarity and reactivity. The hydroxyl group can participate in hydrogen bonding, influencing its solubility in various solvents. The fluorine atom may impart unique electronic properties, affecting the compound's behavior in chemical reactions and interactions with biological systems. Additionally, the methoxy group can enhance lipophilicity, which may influence the compound's pharmacokinetics if it is studied for biological activity. Overall, the structural features of 4-Fluoro-3′-methoxy[1,1′-biphenyl]-3-ol suggest it may have applications in fields such as medicinal chemistry or materials science.
Formula:C13H11FO2
InChI:InChI=1S/C13H11FO2/c1-16-11-4-2-3-9(7-11)10-5-6-12(14)13(15)8-10/h2-8,15H,1H3
InChI key:InChIKey=VFFMCXXMCCHELN-UHFFFAOYSA-N
SMILES:OC=1C=C(C=CC1F)C2=CC(OC)=CC=C2
Synonyms:
  • 4-Fluoro-3′-methoxy[1,1′-biphenyl]-3-ol
  • [1,1′-Biphenyl]-3-ol, 4-fluoro-3′-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.