
CAS 1262001-92-2
:2,3′-Difluoro-2′-methyl[1,1′-biphenyl]-4-ol
Description:
2,3′-Difluoro-2′-methyl[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2 and 3 positions of one phenyl ring, along with a methyl group at the 2′ position and a hydroxyl group at the 4 position, contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the hydroxyl group, which can participate in hydrogen bonding, influencing its solubility in various solvents. The fluorine substituents can enhance the compound's stability and alter its electronic properties, potentially affecting its reactivity and interactions with biological systems. Additionally, the presence of the methyl group may influence steric hindrance and overall molecular conformation. Overall, 2,3′-Difluoro-2′-methyl[1,1′-biphenyl]-4-ol is of interest in various fields, including pharmaceuticals and materials science, due to its distinctive structural features and potential applications.
Formula:C13H10F2O
InChI:InChI=1S/C13H10F2O/c1-8-10(3-2-4-12(8)14)11-6-5-9(16)7-13(11)15/h2-7,16H,1H3
InChI key:InChIKey=VENFHZPHQQNTLN-UHFFFAOYSA-N
SMILES:FC1=C(C=CC(O)=C1)C2=C(C)C(F)=CC=C2
Synonyms:- [1,1′-Biphenyl]-4-ol, 2,3′-difluoro-2′-methyl-
- 2,3′-Difluoro-2′-methyl[1,1′-biphenyl]-4-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.