CAS 1262002-16-3

Methyl 5-fluoro-3′-hydroxy[1,1′-biphenyl]-3-carboxylate

Description:

Methyl 5-fluoro-3′-hydroxy[1,1′-biphenyl]-3-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylate group (-COOCH3) indicates that it is an ester, specifically a methyl ester, contributing to its reactivity and solubility in organic solvents. The 5-fluoro substitution introduces a fluorine atom at the 5-position of the biphenyl, which can influence the compound's electronic properties and biological activity. Additionally, the 3′-hydroxy group provides a site for potential hydrogen bonding and further functionalization. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its synthesis and applications could be relevant in the development of pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact.

Formula: C₁₄H₁₁FO₃

InChI: InChI=1S/C14H11FO3/c1-18-14(17)11-5-10(6-12(15)7-11)9-3-2-4-13(16)8-9/h2-8,16H,1H3

InChI key: InChIKey=SHRQFBKMPPVNBG-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C(C=C(F)C1)C2=CC(O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 5-fluoro-3′-hydroxy-, methyl ester
• Methyl 5-fluoro-3′-hydroxy[1,1′-biphenyl]-3-carboxylate