
CAS 1262002-24-3
:2′-Chloro-4′-ethoxy[1,1′-biphenyl]-3-ol
Description:
2′-Chloro-4′-ethoxy[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 2′ position and an ethoxy group at the 4′ position, along with a hydroxyl group at the 3 position, contributes to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the hydroxyl group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents. The chloro substituent may influence its reactivity, potentially participating in nucleophilic substitution reactions. Additionally, the ethoxy group can provide some hydrophobic character, affecting the compound's overall solubility and interaction with biological systems. The compound may also exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Overall, its structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C14H13ClO2
InChI:InChI=1S/C14H13ClO2/c1-2-17-12-6-7-13(14(15)9-12)10-4-3-5-11(16)8-10/h3-9,16H,2H2,1H3
InChI key:InChIKey=CURJAHOXAXAWLN-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(O)=CC=C2)C=CC(OCC)=C1
Synonyms:- [1,1′-Biphenyl]-3-ol, 2′-chloro-4′-ethoxy-
- 2′-Chloro-4′-ethoxy[1,1′-biphenyl]-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.