CAS 1262002-55-0

3′,5′-Dimethoxy-3-nitro[1,1′-biphenyl]-4-ol

Description:

3′,5′-Dimethoxy-3-nitro[1,1′-biphenyl]-4-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features two methoxy groups (-OCH3) and a nitro group (-NO2) attached to the biphenyl framework, along with a hydroxyl group (-OH) at the 4-position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The methoxy groups can influence the compound's solubility and electronic properties, while the nitro group may impart specific reactivity patterns, such as electrophilic substitution. The hydroxyl group can participate in hydrogen bonding, affecting the compound's physical properties, such as melting and boiling points. Overall, 3′,5′-Dimethoxy-3-nitro[1,1′-biphenyl]-4-ol is a complex molecule with diverse chemical characteristics that can be explored for various synthetic and practical applications.

Formula: C₁₄H₁₃NO₅

InChI: InChI=1S/C14H13NO5/c1-19-11-5-10(6-12(8-11)20-2)9-3-4-14(16)13(7-9)15(17)18/h3-8,16H,1-2H3

InChI key: InChIKey=BXHGCLCIAODABA-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=C(OC)C1)C2=CC(N(=O)=O)=C(O)C=C2

Synonyms:

• 3′,5′-Dimethoxy-3-nitro[1,1′-biphenyl]-4-ol
• [1,1′-Biphenyl]-4-ol, 3′,5′-dimethoxy-3-nitro-