CAS 1262003-03-1
:4-(3-Chloro-5-hydroxyphenyl)-2-thiophenecarboxylic acid
Description:
4-(3-Chloro-5-hydroxyphenyl)-2-thiophenecarboxylic acid is a chemical compound characterized by its unique structure, which includes a thiophene ring and a phenolic moiety. The presence of a chloro group and a hydroxy group on the phenyl ring contributes to its potential reactivity and solubility properties. This compound is likely to exhibit acidic behavior due to the carboxylic acid functional group, which can donate protons in solution. The thiophene ring may impart additional electronic properties, influencing the compound's behavior in various chemical reactions. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. The presence of halogen and hydroxyl groups can enhance biological activity, making it a candidate for further research in medicinal chemistry. Overall, this compound's characteristics, including its functional groups and heterocyclic structure, make it an interesting subject for study in various chemical and biological contexts.
Formula:C11H7ClO3S
InChI:InChI=1S/C11H7ClO3S/c12-8-1-6(2-9(13)4-8)7-3-10(11(14)15)16-5-7/h1-5,13H,(H,14,15)
InChI key:InChIKey=XSIWIYPWPDPKSX-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CS1)C2=CC(Cl)=CC(O)=C2
Synonyms:- 4-(3-Chloro-5-hydroxyphenyl)-2-thiophenecarboxylic acid
- 2-Thiophenecarboxylic acid, 4-(3-chloro-5-hydroxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
