CAS 1262003-39-3

Methyl 5-fluoro-4′-hydroxy-3′-methyl[1,1′-biphenyl]-3-carboxylate

Description:

Methyl 5-fluoro-4′-hydroxy-3′-methyl[1,1′-biphenyl]-3-carboxylate is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methyl group and a fluoro substituent on the biphenyl framework contributes to its unique chemical properties, potentially influencing its reactivity and interaction with biological systems. The hydroxyl group (–OH) at the 4′ position enhances its polarity, which may affect solubility in various solvents. The carboxylate group (–COOCH3) indicates that it is an ester, which can participate in esterification and hydrolysis reactions. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Its specific applications and behavior in chemical reactions would depend on the context of its use, including potential roles in drug development or as a synthetic intermediate. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₅H₁₃FO₃

InChI: InChI=1S/C15H13FO3/c1-9-5-10(3-4-14(9)17)11-6-12(15(18)19-2)8-13(16)7-11/h3-8,17H,1-2H3

InChI key: InChIKey=MDPCELYCCRUUNV-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C(C=C(F)C1)C2=CC(C)=C(O)C=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 5-fluoro-4′-hydroxy-3′-methyl-, methyl ester
• Methyl 5-fluoro-4′-hydroxy-3′-methyl[1,1′-biphenyl]-3-carboxylate