CymitQuimica logo

CAS 1262003-46-2

:

3′-Chloro-4-hydroxy-5′-methyl[1,1′-biphenyl]-3-carbonitrile

Description:
3′-Chloro-4-hydroxy-5′-methyl[1,1′-biphenyl]-3-carbonitrile, identified by its CAS number 1262003-46-2, is a chemical compound that features a biphenyl structure with various functional groups. This compound contains a chloro group, a hydroxy group, and a carbonitrile group, which contribute to its chemical reactivity and potential applications. The presence of the chloro substituent can influence the compound's polarity and solubility, while the hydroxy group may impart hydrogen bonding capabilities, affecting its interactions in biological systems or chemical reactions. The carbonitrile group is known for its electron-withdrawing properties, which can enhance the compound's reactivity in nucleophilic substitution reactions. Overall, the unique combination of these functional groups suggests that this compound may exhibit interesting pharmacological properties or serve as a useful intermediate in organic synthesis. However, specific characteristics such as melting point, boiling point, and solubility would require empirical data for precise evaluation.
Formula:C14H10ClNO
InChI:InChI=1S/C14H10ClNO/c1-9-4-11(7-13(15)5-9)10-2-3-14(17)12(6-10)8-16/h2-7,17H,1H3
InChI key:InChIKey=BMHAKVDQHVZYIX-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(C=CC1O)C2=CC(C)=CC(Cl)=C2
Synonyms:
  • [1,1′-Biphenyl]-3-carbonitrile, 3′-chloro-4-hydroxy-5′-methyl-
  • 3′-Chloro-4-hydroxy-5′-methyl[1,1′-biphenyl]-3-carbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.