CymitQuimica logo

CAS 1262003-94-0

:

3′,5′-Dichloro-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde

Description:
3′,5′-Dichloro-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two chlorine atoms at the 3' and 5' positions on one of the phenyl rings contributes to its chlorinated nature, while the hydroxyl group (-OH) at the 3-position and the aldehyde group (-CHO) at the 4-position introduce functional diversity. This compound is likely to exhibit properties typical of chlorinated aromatic compounds, such as increased stability and potential bioactivity. Its functional groups suggest it may participate in hydrogen bonding and exhibit reactivity characteristic of aldehydes and phenolic compounds. The compound's molecular structure may influence its solubility, melting point, and reactivity in various chemical reactions. Additionally, due to the presence of halogen substituents, it may have implications in environmental chemistry and toxicology, warranting careful handling and assessment of its potential effects.
Formula:C13H8Cl2O2
InChI:InChI=1S/C13H8Cl2O2/c14-11-3-10(4-12(15)6-11)8-1-2-9(7-16)13(17)5-8/h1-7,17H
InChI key:InChIKey=UINBBHZVOIADCN-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=C(Cl)C1)C2=CC(O)=C(C=O)C=C2
Synonyms:
  • [1,1′-Biphenyl]-4-carboxaldehyde, 3′,5′-dichloro-3-hydroxy-
  • 3′,5′-Dichloro-3-hydroxy[1,1′-biphenyl]-4-carboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.