
CAS 1262003-95-1
:5-Bromo-2′,5′-dichloro[1,1′-biphenyl]-3-ol
Description:
5-Bromo-2′,5′-dichloro[1,1′-biphenyl]-3-ol is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of bromine and chlorine substituents on the biphenyl framework significantly influences its chemical properties, including its reactivity and potential biological activity. The hydroxyl (-OH) group at the 3-position contributes to its polarity, enhancing solubility in polar solvents and affecting its interaction with biological systems. This compound may exhibit antimicrobial or antifungal properties due to the halogenated substituents, which are known to enhance biological activity in various organic compounds. Additionally, the presence of multiple halogens can lead to increased stability against degradation, making it of interest in various applications, including pharmaceuticals and agrochemicals. Its specific characteristics, such as melting point, boiling point, and spectral data, would require further investigation through experimental methods or literature for precise values.
Formula:C12H7BrCl2O
InChI:InChI=1S/C12H7BrCl2O/c13-8-3-7(4-10(16)5-8)11-6-9(14)1-2-12(11)15/h1-6,16H
InChI key:InChIKey=PVROTMRGZIPWRP-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(Br)=CC(O)=C2)C=C(Cl)C=C1
Synonyms:- 5-Bromo-2′,5′-dichloro[1,1′-biphenyl]-3-ol
- [1,1′-Biphenyl]-3-ol, 5-bromo-2′,5′-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.