CAS 1262004-85-2

4′-Chloro-3′-cyano-2-methyl[1,1′-biphenyl]-3-carboxylic acid

Description:

4′-Chloro-3′-cyano-2-methyl[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a carboxylic acid functional group (-COOH), a cyano group (-CN), and a chloro substituent (-Cl) on the biphenyl framework, contributing to its chemical reactivity and potential applications. The presence of the cyano group indicates that it may participate in nucleophilic reactions, while the carboxylic acid group can engage in acid-base chemistry. The chlorine atom introduces electronegativity, potentially influencing the compound's polarity and solubility in various solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural complexity and functional groups suggest potential applications in organic synthesis, agrochemicals, or materials science. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₅H₁₀ClNO₂

InChI: InChI=1S/C15H10ClNO2/c1-9-12(3-2-4-13(9)15(18)19)10-5-6-14(16)11(7-10)8-17/h2-7H,1H3,(H,18,19)

InChI key: InChIKey=MRUGSYNQWHCZSL-UHFFFAOYSA-N

SMILES: CC1=C(C=CC=C1C(O)=O)C2=CC(C#N)=C(Cl)C=C2

Synonyms:

• 4′-Chloro-3′-cyano-2-methyl[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 4′-chloro-3′-cyano-2-methyl-