CAS 1262004-89-6

1,2-Dihydro-5-[4-(methylsulfonyl)phenyl]-2-oxo-3-pyridinecarboxylic acid

Description:

1,2-Dihydro-5-[4-(methylsulfonyl)phenyl]-2-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and a carboxylic acid functional group. This compound features a methylsulfonyl group attached to a phenyl ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound's structure suggests potential biological activity, possibly as a pharmaceutical agent, given the presence of the pyridine and sulfonyl moieties, which are often found in biologically active compounds. Its molecular interactions may involve hydrogen bonding and dipole-dipole interactions, influencing its reactivity and stability. As with many organic compounds, it is essential to handle it with care, considering safety data and potential hazards associated with its use. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including medicinal chemistry and material science.

Formula: C₁₃H₁₁NO₅S

InChI: InChI=1S/C13H11NO5S/c1-20(18,19)10-4-2-8(3-5-10)9-6-11(13(16)17)12(15)14-7-9/h2-7H,1H3,(H,14,15)(H,16,17)

InChI key: InChIKey=JYOKLKSWACQICC-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=CC(=CNC1=O)C2=CC=C(S(C)(=O)=O)C=C2

Synonyms:

• 1,2-Dihydro-5-[4-(methylsulfonyl)phenyl]-2-oxo-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 1,2-dihydro-5-[4-(methylsulfonyl)phenyl]-2-oxo-