CAS 1262005-25-3

2-(3-Acetylphenyl)-4-pyridinecarboxylic acid

Description:

2-(3-Acetylphenyl)-4-pyridinecarboxylic acid, identified by its CAS number 1262005-25-3, is an organic compound characterized by its unique structural features, which include a pyridine ring and an acetylphenyl group. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents due to the presence of both carboxylic acid and aromatic functional groups. The presence of the pyridine moiety contributes to its potential as a ligand in coordination chemistry, while the acetyl group can influence its reactivity and interactions in various chemical environments. The compound may exhibit acidic properties due to the carboxylic acid group, allowing it to participate in acid-base reactions. Additionally, its structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, particularly in the development of biologically active molecules. Overall, the compound's characteristics make it of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₄H₁₁NO₃

InChI: InChI=1S/C14H11NO3/c1-9(16)10-3-2-4-11(7-10)13-8-12(14(17)18)5-6-15-13/h2-8H,1H3,(H,17,18)

InChI key: InChIKey=IQIORHNBKPDFLX-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1C=C(C=CC1)C2=CC(C(O)=O)=CC=N2

Synonyms:

• 2-(3-Acetylphenyl)-4-pyridinecarboxylic acid
• 4-Pyridinecarboxylic acid, 2-(3-acetylphenyl)-