CAS 1262005-98-0

4′-Ethyl 3′-fluoro-5-(trifluoromethyl)[1,1′-biphenyl]-3,4′-dicarboxylate

Description:

4′-Ethyl 3′-fluoro-5-(trifluoromethyl)[1,1′-biphenyl]-3,4′-dicarboxylate is a complex organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of an ethyl group and a trifluoromethyl group contributes to its unique chemical properties, including increased lipophilicity and potential reactivity. The fluorine substituent enhances the compound's stability and can influence its electronic properties, making it of interest in various chemical applications. The dicarboxylate functional groups suggest potential for forming esters or participating in further chemical reactions, such as esterification or amidation. This compound may exhibit interesting biological activity or serve as a precursor in synthetic chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its specific interactions and behavior in different environments would depend on factors such as solvent polarity, temperature, and the presence of other reactive species. Overall, this compound exemplifies the complexity and versatility of fluorinated organic molecules in modern chemistry.

Formula: C₁₇H₁₂F₄O₄

InChI: InChI=1S/C17H12F4O4/c1-2-25-16(24)13-4-3-9(8-14(13)18)10-5-11(15(22)23)7-12(6-10)17(19,20)21/h3-8H,2H2,1H3,(H,22,23)

InChI key: InChIKey=BJOCHCJFNWMFAX-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(C=C(C(O)=O)C1)C2=CC(F)=C(C(OCC)=O)C=C2

Synonyms:

• [1,1′-Biphenyl]-3,4′-dicarboxylic acid, 3′-fluoro-5-(trifluoromethyl)-, 4′-ethyl ester
• 4′-Ethyl 3′-fluoro-5-(trifluoromethyl)[1,1′-biphenyl]-3,4′-dicarboxylate