CAS 1262006-39-2
:5-(4-Chloro-3-methylphenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
Description:
5-(4-Chloro-3-methylphenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of a chloro substituent and a methyl group on the phenyl ring contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit moderate solubility in organic solvents due to its aromatic and polar functional groups. The diketone structure within the pyridine framework suggests potential for tautomerism, which can influence its chemical behavior. Additionally, the carboxylic acid group may participate in hydrogen bonding, affecting its interactions in biological systems. Such compounds are often studied for their pharmacological properties, and the specific arrangement of substituents can lead to varied biological activities, including antimicrobial or anti-inflammatory effects. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and drug development.
Formula:C13H10ClNO3
InChI:InChI=1S/C13H10ClNO3/c1-7-4-8(2-3-11(7)14)10-5-9(13(17)18)6-15-12(10)16/h2-6H,1H3,(H,15,16)(H,17,18)
InChI key:InChIKey=BRSMQFRXIYQEJK-UHFFFAOYSA-N
SMILES:O=C1C(=CC(C(O)=O)=CN1)C2=CC(C)=C(Cl)C=C2
Synonyms:- 3-Pyridinecarboxylic acid, 5-(4-chloro-3-methylphenyl)-1,6-dihydro-6-oxo-
- 5-(4-Chloro-3-methylphenyl)-1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
