CAS 1262006-40-5

5-Methoxy-3′-(1-pyrrolidinylcarbonyl)[1,1′-biphenyl]-3-carboxylic acid

Description:

5-Methoxy-3′-(1-pyrrolidinylcarbonyl)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with a methoxy group and a pyrrolidinylcarbonyl moiety. This compound features a carboxylic acid functional group, contributing to its potential acidity and reactivity. The presence of the methoxy group suggests possible applications in medicinal chemistry, as methoxy-substituted compounds often exhibit enhanced biological activity. The pyrrolidinyl group may impart specific pharmacological properties, potentially influencing the compound's interaction with biological targets. The compound's molecular structure indicates it may participate in hydrogen bonding due to the carboxylic acid, which can enhance solubility in polar solvents. Additionally, the biphenyl framework may provide stability and contribute to the compound's overall lipophilicity. Overall, this compound's unique structural features suggest it could be of interest in drug development and other chemical applications, although specific biological activities and properties would require further investigation.

Formula: C₁₉H₁₉NO₄

InChI: InChI=1S/C19H19NO4/c1-24-17-11-15(10-16(12-17)19(22)23)13-5-4-6-14(9-13)18(21)20-7-2-3-8-20/h4-6,9-12H,2-3,7-8H2,1H3,(H,22,23)

InChI key: InChIKey=LAWPELLMQDTDOY-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C(C=C(OC)C1)C2=CC(C(=O)N3CCCC3)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 5-methoxy-3′-(1-pyrrolidinylcarbonyl)-
• 5-Methoxy-3′-(1-pyrrolidinylcarbonyl)[1,1′-biphenyl]-3-carboxylic acid