CAS 1262006-49-4

4-Chloro-3′-cyano-2′-fluoro[1,1′-biphenyl]-3-carboxylic acid

Description:

4-Chloro-3′-cyano-2′-fluoro[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features several functional groups, including a carboxylic acid (-COOH), a cyano group (-CN), and a chloro substituent (-Cl) on one of the phenyl rings, as well as a fluoro group (-F) on the adjacent ring. These substituents contribute to its chemical reactivity and potential applications in various fields, such as pharmaceuticals or agrochemicals. The presence of the cyano group indicates potential for further chemical modifications, while the carboxylic acid group can participate in acid-base reactions. The compound's unique combination of halogen and cyano functionalities may also influence its solubility, stability, and interaction with biological systems. Overall, 4-Chloro-3′-cyano-2′-fluoro[1,1′-biphenyl]-3-carboxylic acid is a versatile compound with potential utility in synthetic organic chemistry.

Formula: C₁₄H₇ClFNO₂

InChI: InChI=1S/C14H7ClFNO2/c15-12-5-4-8(6-11(12)14(18)19)10-3-1-2-9(7-17)13(10)16/h1-6H,(H,18,19)

InChI key: InChIKey=NXZQFWFVONUJSI-UHFFFAOYSA-N

SMILES: FC1=C(C2=CC(C(O)=O)=C(Cl)C=C2)C=CC=C1C#N

Synonyms:

• 4-Chloro-3′-cyano-2′-fluoro[1,1′-biphenyl]-3-carboxylic acid
• [1,1′-Biphenyl]-3-carboxylic acid, 4-chloro-3′-cyano-2′-fluoro-