CAS 1262006-74-5

5-(3-Carboxy-5-fluorophenyl)-2-chloro-4-pyridinecarboxylic acid

Description:

5-(3-Carboxy-5-fluorophenyl)-2-chloro-4-pyridinecarboxylic acid, identified by its CAS number 1262006-74-5, is a chemical compound that features a complex structure incorporating both aromatic and heterocyclic components. This substance contains a pyridine ring, which is a six-membered aromatic ring with one nitrogen atom, and is substituted with a carboxylic acid group and a chlorine atom, contributing to its acidic properties and potential reactivity. The presence of a fluorinated phenyl group enhances its lipophilicity and may influence its biological activity. The carboxylic acid functional group is known for its ability to form hydrogen bonds, which can affect solubility and interaction with biological targets. This compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to its unique structural features that could impart specific biological activities. Its synthesis and characterization would typically involve standard organic chemistry techniques, including functional group transformations and purification methods.

Formula: C₁₃H₇ClFNO₄

InChI: InChI=1S/C13H7ClFNO4/c14-11-4-9(13(19)20)10(5-16-11)6-1-7(12(17)18)3-8(15)2-6/h1-5H,(H,17,18)(H,19,20)

InChI key: InChIKey=WLXDQLWEHWOBOH-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(C2=CC(C(O)=O)=CC(F)=C2)=CN=C(Cl)C1

Synonyms:

• 4-Pyridinecarboxylic acid, 5-(3-carboxy-5-fluorophenyl)-2-chloro-
• 5-(3-Carboxy-5-fluorophenyl)-2-chloro-4-pyridinecarboxylic acid