
CAS 1262009-16-4
:4′-(1,1-Dimethylethyl)-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid
Description:
4′-(1,1-Dimethylethyl)-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid functional group (-COOH) indicates that it can act as an acid, capable of donating protons in solution. The compound features a tert-butyl group (1,1-dimethylethyl) and a trifluoromethyl group (-CF3), which significantly influence its chemical properties, including its hydrophobicity and reactivity. The trifluoromethyl group is known for enhancing the compound's lipophilicity and can affect its biological activity. This compound may exhibit interesting properties in various applications, including pharmaceuticals, agrochemicals, and materials science, due to the unique combination of functional groups and the biphenyl backbone. Its specific interactions and stability can be influenced by environmental factors such as temperature and pH. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of fluorinated groups.
Formula:C18H17F3O2
InChI:InChI=1S/C18H17F3O2/c1-17(2,3)14-6-4-11(5-7-14)12-8-13(16(22)23)10-15(9-12)18(19,20)21/h4-10H,1-3H3,(H,22,23)
InChI key:InChIKey=ZXDMNKRIZXBFJP-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C=C(C(O)=O)C1)C2=CC=C(C(C)(C)C)C=C2
Synonyms:- 4′-(1,1-Dimethylethyl)-5-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 4′-(1,1-dimethylethyl)-5-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.