
CAS 1262009-69-7
:4′-(Methylsulfonyl)-5-nitro[1,1′-biphenyl]-3-carboxylic acid
Description:
4′-(Methylsulfonyl)-5-nitro[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a biphenyl core substituted with a methylsulfonyl group, a nitro group, and a carboxylic acid functional group. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The methylsulfonyl group contributes to its potential as a polar molecule, while the nitro group can impart specific reactivity and stability characteristics. The presence of these functional groups suggests that the compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's structure may influence its biological activity, making it of interest in pharmaceutical research. Safety data and handling precautions should be considered, as compounds with nitro and sulfonyl groups can exhibit toxicity or environmental hazards. Overall, this compound's unique functional groups and biphenyl framework make it a subject of interest in both synthetic and medicinal chemistry.
Formula:C14H11NO6S
InChI:InChI=1S/C14H11NO6S/c1-22(20,21)13-4-2-9(3-5-13)10-6-11(14(16)17)8-12(7-10)15(18)19/h2-8H,1H3,(H,16,17)
InChI key:InChIKey=IBEZTPQHQDJPOE-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(N(=O)=O)C1)C2=CC=C(S(C)(=O)=O)C=C2
Synonyms:- 4′-(Methylsulfonyl)-5-nitro[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 4′-(methylsulfonyl)-5-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.