CAS 1262010-57-0

6-Chloro-2′-methoxy-5′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid

Description:

6-Chloro-2′-methoxy-5′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 6-position and a trifluoromethyl group at the 5′-position contributes to its unique reactivity and physical properties. The methoxy group at the 2′-position enhances its solubility in organic solvents, while the carboxylic acid functional group at the 3-position provides acidic properties, allowing for potential interactions in various chemical reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in agrochemicals or as a building block in organic synthesis. The trifluoromethyl group is particularly notable for imparting lipophilicity and influencing the compound's electronic properties, which can affect its behavior in biological systems. Overall, this compound's unique functional groups and structural features make it a subject of interest in both synthetic and medicinal chemistry.

Formula: C₁₅H₁₀ClF₃O₃

InChI: InChI=1S/C15H10ClF3O3/c1-22-13-5-3-9(15(17,18)19)7-11(13)10-6-8(14(20)21)2-4-12(10)16/h2-7H,1H3,(H,20,21)

InChI key: InChIKey=RGCFGXYVQGDYKS-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=C(C(F)(F)F)C=C1)C2=CC(C(O)=O)=CC=C2Cl

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 6-chloro-2′-methoxy-5′-(trifluoromethyl)-
• 6-Chloro-2′-methoxy-5′-(trifluoromethyl)[1,1′-biphenyl]-3-carboxylic acid