CAS 1262010-71-8

3′-Cyano-3-nitro[1,1′-biphenyl]-4-carboxylic acid

Description:

3′-Cyano-3-nitro[1,1′-biphenyl]-4-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a cyano group (-CN) and a nitro group (-NO2) at the 3' position of the biphenyl, along with a carboxylic acid group (-COOH) at the 4 position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and materials science. The cyano group can participate in nucleophilic reactions, while the nitro group can undergo reduction reactions. The carboxylic acid group provides acidity and can form salts or esters. Additionally, the compound's structural features may influence its solubility, melting point, and overall stability. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.

Formula: C₁₄H₈N₂O₄

InChI: InChI=1S/C14H8N2O4/c15-8-9-2-1-3-10(6-9)11-4-5-12(14(17)18)13(7-11)16(19)20/h1-7H,(H,17,18)

InChI key: InChIKey=MXCFOSDHQDLEMV-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=C(C=CC1C(O)=O)C2=CC(C#N)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-4-carboxylic acid, 3′-cyano-3-nitro-
• 3′-Cyano-3-nitro[1,1′-biphenyl]-4-carboxylic acid