CAS 1262010-76-3

2-(3,5-Dimethoxyphenyl)-4-pyridinol

Description:

2-(3,5-Dimethoxyphenyl)-4-pyridinol, identified by its CAS number 1262010-76-3, is an organic compound characterized by its unique structural features, which include a pyridine ring and a substituted phenyl group. The presence of two methoxy groups on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest for further research in drug development. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact of this compound would need to be evaluated through appropriate studies.

Formula: C₁₃H₁₃NO₃

InChI: InChI=1S/C13H13NO3/c1-16-11-5-9(6-12(8-11)17-2)13-7-10(15)3-4-14-13/h3-8H,1-2H3,(H,14,15)

InChI key: InChIKey=FKFYFSUWZPNDNN-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=C(OC)C1)C2=CC(O)=CC=N2

Synonyms:

• 2-(3,5-Dimethoxyphenyl)-4-pyridinol
• 4-Pyridinol, 2-(3,5-dimethoxyphenyl)-