CymitQuimica logo

CAS 1262010-80-9

:

3-(3,4-Difluorophenyl)-4-pyridinecarboxylic acid

Description:
3-(3,4-Difluorophenyl)-4-pyridinecarboxylic acid is an organic compound characterized by its unique structure, which includes a pyridine ring and a carboxylic acid functional group. The presence of the difluorophenyl moiety contributes to its potential as a bioactive molecule, influencing its solubility, reactivity, and interaction with biological targets. This compound typically exhibits moderate to high polarity due to the carboxylic acid group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The difluorination introduces electron-withdrawing effects, which can affect the acidity of the carboxylic group and the overall electronic properties of the molecule. Additionally, the compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its synthesis and characterization would involve standard organic reactions, and it may be analyzed using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its structure and purity. Overall, 3-(3,4-Difluorophenyl)-4-pyridinecarboxylic acid represents a valuable compound in the field of organic and medicinal chemistry.
Formula:C12H7F2NO2
InChI:InChI=1S/C12H7F2NO2/c13-10-2-1-7(5-11(10)14)9-6-15-4-3-8(9)12(16)17/h1-6H,(H,16,17)
InChI key:InChIKey=DBIMGHPRDUOGRS-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(=CN=CC1)C2=CC(F)=C(F)C=C2
Synonyms:
  • 4-Pyridinecarboxylic acid, 3-(3,4-difluorophenyl)-
  • 3-(3,4-Difluorophenyl)-4-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.