CAS 1262010-81-0

2′-Formyl-4-methoxy[1,1′-biphenyl]-2-carboxylic acid

Description:

2′-Formyl-4-methoxy[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a formyl group (-CHO) and a carboxylic acid group (-COOH) at the 2-position of the biphenyl, along with a methoxy group (-OCH3) at the 4-position. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The formyl group can participate in various reactions, such as condensation and reduction, while the carboxylic acid can engage in acid-base reactions and esterification. The methoxy group may influence the compound's solubility and electronic properties, making it a candidate for further chemical modifications. Additionally, the compound's structural features suggest potential biological activity, warranting investigation in pharmacological studies. Overall, 2′-Formyl-4-methoxy[1,1′-biphenyl]-2-carboxylic acid is a versatile compound with significant implications in chemical research and applications.

Formula: C₁₅H₁₂O₄

InChI: InChI=1S/C15H12O4/c1-19-11-6-7-13(14(8-11)15(17)18)12-5-3-2-4-10(12)9-16/h2-9H,1H3,(H,17,18)

InChI key: InChIKey=MDTFXGRZJUAYAG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(C=CC(OC)=C1)C2=C(C=O)C=CC=C2

Synonyms:

• 2′-Formyl-4-methoxy[1,1′-biphenyl]-2-carboxylic acid
• 2-(2-Formylphenyl)-5-methoxybenzoic acid
• [1,1′-Biphenyl]-2-carboxylic acid, 2′-formyl-4-methoxy-