CAS 1262010-85-4

2-Methoxy-3′-[(methylsulfonyl)amino][1,1′-biphenyl]-3-carboxylic acid

Description:

2-Methoxy-3′-[(methylsulfonyl)amino][1,1′-biphenyl]-3-carboxylic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a methoxy group (-OCH3) and a methylsulfonylamino group (-SO2CH3) attached to the biphenyl framework, contributing to its unique chemical properties. The presence of a carboxylic acid group (-COOH) indicates that it can participate in acid-base reactions and may exhibit polar characteristics, enhancing its solubility in polar solvents. The methylsulfonylamino group can influence the compound's biological activity and interactions, potentially making it relevant in pharmaceutical applications. Additionally, the methoxy group can affect the compound's electronic properties and steric hindrance. Overall, this compound's structural features suggest it may have interesting reactivity and potential applications in medicinal chemistry or as a building block in organic synthesis.

Formula: C₁₅H₁₅NO₅S

InChI: InChI=1S/C15H15NO5S/c1-21-14-12(7-4-8-13(14)15(17)18)10-5-3-6-11(9-10)16-22(2,19)20/h3-9,16H,1-2H3,(H,17,18)

InChI key: InChIKey=NERIKZDLNYLKFO-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=CC=C1C(O)=O)C2=CC(NS(C)(=O)=O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 2-methoxy-3′-[(methylsulfonyl)amino]-
• 2-Methoxy-3′-[(methylsulfonyl)amino][1,1′-biphenyl]-3-carboxylic acid