
CAS 1262010-98-9
:4′-Ethyl-5-hydroxy[1,1′-biphenyl]-3-carboxylic acid
Description:
4′-Ethyl-5-hydroxy[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features an ethyl group at the para position relative to the hydroxyl group and a carboxylic acid functional group at the meta position. The presence of the hydroxyl group contributes to its potential as a phenolic compound, which may exhibit antioxidant properties. The carboxylic acid group enhances its solubility in polar solvents and can participate in various chemical reactions, such as esterification and acid-base reactions. The compound's structural features suggest it may have applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, its unique combination of functional groups may influence its biological activity and reactivity, making it a subject of interest in medicinal chemistry and materials science. Overall, 4′-Ethyl-5-hydroxy[1,1′-biphenyl]-3-carboxylic acid is a versatile compound with potential utility in various chemical and industrial applications.
Formula:C15H14O3
InChI:InChI=1S/C15H14O3/c1-2-10-3-5-11(6-4-10)12-7-13(15(17)18)9-14(16)8-12/h3-9,16H,2H2,1H3,(H,17,18)
InChI key:InChIKey=ZVJQFCSEVUCJSS-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=C(O)C1)C2=CC=C(CC)C=C2
Synonyms:- 4′-Ethyl-5-hydroxy[1,1′-biphenyl]-3-carboxylic acid
- [1,1′-Biphenyl]-3-carboxylic acid, 4′-ethyl-5-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.